C25H33ClN2O6 — CID 23985704
methyl 5-[(3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate (PubChem CID 23985704) has the molecular formula C25H33ClN2O6 and a molecular weight of 493.00 g/mol. Its IUPAC name is methyl 5-[(3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
|---|---|
| PubChem CID | 23985704 |
| Molecular Formula | C25H33ClN2O6 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl 5-[(3S)-5-chloro-3-hydroxy-3-[(E,2R)-6-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-6-oxohex-3-en-2-yl]-2-oxoindol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@](O)([C@H](C)/C=C/CC(=O)N2CCC[C@H]2CO)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H33ClN2O6/c1-17(7-5-9-22(30)27-14-6-8-19(27)16-29)25(33)20-15-18(26)11-12-21(20)28(24(25)32)13-4-3-10-23(31)34-2/h5,7,11-12,15,17,19,29,33H,3-4,6,8-10,13-14,16H2,1-2H3/b7-5+/t17-,19+,25+/m1/s1 |
| InChIKey | WVYSGVQAKVXIIV-XVHBLJHRSA-N |
| XLogP | 2.78 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|