C28H31N5O4 — CID 23901907
(3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopyrrolidin-1-yl)-1-phenylindol-2-one (PubChem CID 23901907) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopyrrolidin-1-yl)-1-phenylindol-2-one.
| Compound Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopyrrolidin-1-yl)-1-phenylindol-2-one |
|---|---|
| PubChem CID | 23901907 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (3R)-3-hydroxy-3-[(E,2S)-6-[4-(2-hydroxyethyl)triazol-1-yl]hex-3-en-2-yl]-5-(2-oxopyrrolidin-1-yl)-1-phenylindol-2-one |
| SMILES | C[C@@H](/C=C/CCn1cc(CCO)nn1)[C@]1(O)C(=O)N(c2ccccc2)c2ccc(N3CCCC3=O)cc21 |
| InChI | InChI=1S/C28H31N5O4/c1-20(8-5-6-15-31-19-21(14-17-34)29-30-31)28(37)24-18-23(32-16-7-11-26(32)35)12-13-25(24)33(27(28)36)22-9-3-2-4-10-22/h2-5,8-10,12-13,18-20,34,37H,6-7,11,14-17H2,1H3/b8-5+/t20-,28+/m0/s1 |
| InChIKey | CPQYBEQEEBDLMR-GPZVPHGXSA-N |
| XLogP | 3.09 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|