C20H28ClNO5 — CID 23874982
(2R,3R,4S)-4-(4-chlorophenyl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23874982) has the molecular formula C20H28ClNO5 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2R,3R,4S)-4-(4-chlorophenyl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-4-(4-chlorophenyl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23874982 |
| Molecular Formula | C20H28ClNO5 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (2R,3R,4S)-4-(4-chlorophenyl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCOC)=C[C@H](c2ccc(Cl)cc2)[C@H]1CCCO |
| InChI | InChI=1S/C20H28ClNO5/c1-3-26-20-16(5-4-11-23)17(14-6-8-15(21)9-7-14)13-18(27-20)19(24)22-10-12-25-2/h6-9,13,16-17,20,23H,3-5,10-12H2,1-2H3,(H,22,24)/t16-,17-,20-/m1/s1 |
| InChIKey | BAUJYOUEVIHZSP-MBOZVWFJSA-N |
| XLogP | 2.85 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|