C24H32N2O6 — CID 6671168
(2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671168) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671168 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-(3-hydroxypropyl)-N-(2-methoxyethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCOC)=C[C@H](c2cn(C(C)=O)c3ccccc23)[C@H]1CCCO |
| InChI | InChI=1S/C24H32N2O6/c1-4-31-24-18(9-7-12-27)19(14-22(32-24)23(29)25-11-13-30-3)20-15-26(16(2)28)21-10-6-5-8-17(20)21/h5-6,8,10,14-15,18-19,24,27H,4,7,9,11-13H2,1-3H3,(H,25,29)/t18-,19+,24-/m1/s1 |
| InChIKey | SUVNFOZJJMLUOQ-YDIMBITNSA-N |
| XLogP | 2.81 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|