C35H46N4O8 — CID 6671958
(2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671958) has the molecular formula C35H46N4O8 and a molecular weight of 650.77 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671958 |
| Molecular Formula | C35H46N4O8 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCCCC(=O)Nc2ccccc2N)=C[C@H](c2cn(C(C)=O)c3ccccc23)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C35H46N4O8/c1-3-46-35-26(15-18-44-20-21-45-19-17-40)27(28-23-39(24(2)41)31-13-7-4-10-25(28)31)22-32(47-35)34(43)37-16-9-8-14-33(42)38-30-12-6-5-11-29(30)36/h4-7,10-13,22-23,26-27,35,40H,3,8-9,14-21,36H2,1-2H3,(H,37,43)(H,38,42)/t26-,27-,35+/m0/s1 |
| InChIKey | MJWJLVOXOWKPLH-PDTNBVABSA-N |
| XLogP | 4.20 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|