C31H38N2O7 — CID 3363592
4-(1-acetylindol-3-yl)-N-benzyl-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3363592) has the molecular formula C31H38N2O7 and a molecular weight of 550.65 g/mol. Its IUPAC name is 4-(1-acetylindol-3-yl)-N-benzyl-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1-acetylindol-3-yl)-N-benzyl-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3363592 |
| Molecular Formula | C31H38N2O7 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 4-(1-acetylindol-3-yl)-N-benzyl-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)NCc2ccccc2)=CC(c2cn(C(C)=O)c3ccccc23)C1CCOCCOCCO |
| InChI | InChI=1S/C31H38N2O7/c1-3-39-31-25(13-15-37-17-18-38-16-14-34)26(27-21-33(22(2)35)28-12-8-7-11-24(27)28)19-29(40-31)30(36)32-20-23-9-5-4-6-10-23/h4-12,19,21,25-26,31,34H,3,13-18,20H2,1-2H3,(H,32,36) |
| InChIKey | YECBMVCNYUBKDW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|