C32H40N4O6 — CID 6671163
(2R,3R,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671163) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671163 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCCCC(=O)Nc2ccccc2N)=C[C@H](c2cn(C(C)=O)c3ccccc23)[C@H]1CCCO |
| InChI | InChI=1S/C32H40N4O6/c1-3-41-32-23(12-10-18-37)24(25-20-36(21(2)38)28-15-7-4-11-22(25)28)19-29(42-32)31(40)34-17-9-8-16-30(39)35-27-14-6-5-13-26(27)33/h4-7,11,13-15,19-20,23-24,32,37H,3,8-10,12,16-18,33H2,1-2H3,(H,34,40)(H,35,39)/t23-,24+,32-/m1/s1 |
| InChIKey | MPWMFHRWYXBKBZ-MKVNITDJSA-N |
| XLogP | 4.56 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|