C33H45N3O9 — CID 4048898
methyl 4-[6-[[5-(2-aminoanilino)-5-oxopentyl]carbamoyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 4048898) has the molecular formula C33H45N3O9 and a molecular weight of 627.74 g/mol. Its IUPAC name is methyl 4-[6-[[5-(2-aminoanilino)-5-oxopentyl]carbamoyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[6-[[5-(2-aminoanilino)-5-oxopentyl]carbamoyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 4048898 |
| Molecular Formula | C33H45N3O9 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | methyl 4-[6-[[5-(2-aminoanilino)-5-oxopentyl]carbamoyl]-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | CCOC1OC(C(=O)NCCCCC(=O)Nc2ccccc2N)=CC(c2ccc(C(=O)OC)cc2)C1CCOCCOCCO |
| InChI | InChI=1S/C33H45N3O9/c1-3-44-33-25(15-18-42-20-21-43-19-17-37)26(23-11-13-24(14-12-23)32(40)41-2)22-29(45-33)31(39)35-16-7-6-10-30(38)36-28-9-5-4-8-27(28)34/h4-5,8-9,11-14,22,25-26,33,37H,3,6-7,10,15-21,34H2,1-2H3,(H,35,39)(H,36,38) |
| InChIKey | NHDQTIUFNBCLBW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 167.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|