C23H36N2O6 — CID 6668265
(2R,3R,4S)-N-(2-aminophenyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668265) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is (2R,3R,4S)-N-(2-aminophenyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-N-(2-aminophenyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668265 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (2R,3R,4S)-N-(2-aminophenyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccccc2N)=C[C@H](C(C)C)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C23H36N2O6/c1-4-30-23-17(9-11-28-13-14-29-12-10-26)18(16(2)3)15-21(31-23)22(27)25-20-8-6-5-7-19(20)24/h5-8,15-18,23,26H,4,9-14,24H2,1-3H3,(H,25,27)/t17-,18-,23-/m1/s1 |
| InChIKey | DCVVYBXNMNDBAC-PMAPCBKXSA-N |
| XLogP | 2.79 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|