C24H31NO7S — CID 6670979
(2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670979) has the molecular formula C24H31NO7S and a molecular weight of 477.58 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670979 |
| Molecular Formula | C24H31NO7S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)Nc2ccccc2O)=C[C@@H](c2ccsc2)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C24H31NO7S/c1-2-31-24-18(7-10-29-12-13-30-11-9-26)19(17-8-14-33-16-17)15-22(32-24)23(28)25-20-5-3-4-6-21(20)27/h3-6,8,14-16,18-19,24,26-27H,2,7,9-13H2,1H3,(H,25,28)/t18-,19+,24+/m1/s1 |
| InChIKey | LPDAQDCPKHGSPO-IMWIBFENSA-N |
| XLogP | 3.48 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|