C33H37NO7 — CID 6669263
(2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669263) has the molecular formula C33H37NO7 and a molecular weight of 559.66 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669263 |
| Molecular Formula | C33H37NO7 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-4-(9H-fluoren-1-yl)-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)Nc2ccccc2O)=C[C@@H](c2cccc3c2Cc2ccccc2-3)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C33H37NO7/c1-2-40-33-26(14-16-38-18-19-39-17-15-35)28(21-31(41-33)32(37)34-29-12-5-6-13-30(29)36)25-11-7-10-24-23-9-4-3-8-22(23)20-27(24)25/h3-13,21,26,28,33,35-36H,2,14-20H2,1H3,(H,34,37)/t26-,28+,33+/m1/s1 |
| InChIKey | VKSNSZCZEHXQAC-YAKYPSBCSA-N |
| XLogP | 4.99 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|