C31H34N4O6 — CID 6671733
(2R,3S,4S)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671733) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is (2R,3S,4S)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671733 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (2R,3S,4S)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@H](c2cccc3c2Cc2ccccc2-3)[C@@H]1CCCO |
| InChI | InChI=1S/C31H34N4O6/c1-2-40-31-25(11-6-16-36)27(24-10-5-9-23-22-8-4-3-7-20(22)17-26(23)24)18-28(41-31)30(37)33-15-14-32-29-13-12-21(19-34-29)35(38)39/h3-5,7-10,12-13,18-19,25,27,31,36H,2,6,11,14-17H2,1H3,(H,32,34)(H,33,37)/t25-,27+,31+/m0/s1 |
| InChIKey | QKTFKOGTHTUCJE-ZRLKGHKBSA-N |
| XLogP | 4.54 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|