C27H30N4O8 — CID 6670877
(2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670877) has the molecular formula C27H30N4O8 and a molecular weight of 538.56 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670877 |
| Molecular Formula | C27H30N4O8 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (2S,3R,4R)-2-ethoxy-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@@H](c2coc3ccccc3c2=O)[C@H]1CCCO |
| InChI | InChI=1S/C27H30N4O8/c1-2-37-27-18(7-5-13-32)20(21-16-38-22-8-4-3-6-19(22)25(21)33)14-23(39-27)26(34)29-12-11-28-24-10-9-17(15-30-24)31(35)36/h3-4,6,8-10,14-16,18,20,27,32H,2,5,7,11-13H2,1H3,(H,28,30)(H,29,34)/t18-,20-,27+/m1/s1 |
| InChIKey | KOCUBXOWHJSMOL-HMTCLSAISA-N |
| XLogP | 3.07 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|