C26H28N4O9 — CID 6669804
(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669804) has the molecular formula C26H28N4O9 and a molecular weight of 540.53 g/mol. Its IUPAC name is (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669804 |
| Molecular Formula | C26H28N4O9 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cn1)C1=C[C@H](c2coc3ccccc3c2=O)C[C@H](OCCOCCO)O1 |
| InChI | InChI=1S/C26H28N4O9/c31-9-10-36-11-12-37-24-14-17(20-16-38-21-4-2-1-3-19(21)25(20)32)13-22(39-24)26(33)28-8-7-27-23-6-5-18(15-29-23)30(34)35/h1-6,13,15-17,24,31H,7-12,14H2,(H,27,29)(H,28,33)/t17-,24+/m0/s1 |
| InChIKey | FTHDBROWVQBVSE-BXKMTCNYSA-N |
| XLogP | 2.06 |
| TPSA | 175.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|