C25H26N2O7 — CID 6669214
(2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669214) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669214 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)C1=C[C@@H](c2coc3ccccc3c2=O)C[C@@H](OCCOCCO)O1 |
| InChI | InChI=1S/C25H26N2O7/c26-19-6-2-3-7-20(19)27-25(30)22-13-16(14-23(34-22)32-12-11-31-10-9-28)18-15-33-21-8-4-1-5-17(21)24(18)29/h1-8,13,15-16,23,28H,9-12,14,26H2,(H,27,30)/t16-,23+/m1/s1 |
| InChIKey | SCPGEYPCHIEKMN-MWTRTKDXSA-N |
| XLogP | 2.75 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|