C32H33N3O7 — CID 6670394
(2S,4S)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-(1-benzofuran-3-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6670394) has the molecular formula C32H33N3O7 and a molecular weight of 571.63 g/mol. Its IUPAC name is (2S,4S)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-(1-benzofuran-3-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-(1-benzofuran-3-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6670394 |
| Molecular Formula | C32H33N3O7 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | (2S,4S)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-4-(1-benzofuran-3-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)C2=C[C@@H](c3coc4ccccc34)C[C@@H](OCCOCCO)O2)cc1 |
| InChI | InChI=1S/C32H33N3O7/c33-26-6-2-3-7-27(26)35-31(37)22-11-9-21(10-12-22)19-34-32(38)29-17-23(18-30(42-29)40-16-15-39-14-13-36)25-20-41-28-8-4-1-5-24(25)28/h1-12,17,20,23,30,36H,13-16,18-19,33H2,(H,34,38)(H,35,37)/t23-,30+/m1/s1 |
| InChIKey | DDSCALDADLORDV-DJUQAAIZSA-N |
| XLogP | 4.32 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|