C32H35N3O8 — CID 6668991
methyl 4-[(2R,4R)-6-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylcarbamoyl]-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6668991) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-6-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylcarbamoyl]-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-6-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylcarbamoyl]-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6668991 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | methyl 4-[(2R,4R)-6-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylcarbamoyl]-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C=C(C(=O)NCc3ccc(C(=O)Nc4ccccc4N)cc3)O[C@@H](OCCOCCO)C2)cc1 |
| InChI | InChI=1S/C32H35N3O8/c1-40-32(39)24-12-10-22(11-13-24)25-18-28(43-29(19-25)42-17-16-41-15-14-36)31(38)34-20-21-6-8-23(9-7-21)30(37)35-27-5-3-2-4-26(27)33/h2-13,18,25,29,36H,14-17,19-20,33H2,1H3,(H,34,38)(H,35,37)/t25-,29+/m0/s1 |
| InChIKey | QZRDNFRNLXUIFV-ABYGYWHVSA-N |
| XLogP | 3.36 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|