C25H28ClNO6 — CID 23892275
methyl 4-[(2R,4R)-6-[(4-chlorophenyl)methylcarbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 23892275) has the molecular formula C25H28ClNO6 and a molecular weight of 473.95 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-6-[(4-chlorophenyl)methylcarbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-6-[(4-chlorophenyl)methylcarbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 23892275 |
| Molecular Formula | C25H28ClNO6 |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | methyl 4-[(2R,4R)-6-[(4-chlorophenyl)methylcarbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C=C(C(=O)NCc3ccc(Cl)cc3)O[C@@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C25H28ClNO6/c1-31-25(30)19-8-6-18(7-9-19)20-14-22(33-23(15-20)32-13-3-2-12-28)24(29)27-16-17-4-10-21(26)11-5-17/h4-11,14,20,23,28H,2-3,12-13,15-16H2,1H3,(H,27,29)/t20-,23+/m0/s1 |
| InChIKey | KTNJIEHRIUFDQZ-NZQKXSOJSA-N |
| XLogP | 3.95 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|