C24H28N2O6 — CID 6670196
methyl 4-[(2S,4S)-6-[(2-aminophenyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6670196) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 4-[(2S,4S)-6-[(2-aminophenyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2S,4S)-6-[(2-aminophenyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6670196 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | methyl 4-[(2S,4S)-6-[(2-aminophenyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C=C(C(=O)Nc3ccccc3N)O[C@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C24H28N2O6/c1-30-24(29)17-10-8-16(9-11-17)18-14-21(32-22(15-18)31-13-5-4-12-27)23(28)26-20-7-3-2-6-19(20)25/h2-3,6-11,14,18,22,27H,4-5,12-13,15,25H2,1H3,(H,26,28)/t18-,22+/m1/s1 |
| InChIKey | TWLTXEBXMSXUET-GCJKJVERSA-N |
| XLogP | 3.20 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|