C23H24F3NO4 — CID 24746718
(2S,4S)-2-(4-hydroxybutoxy)-N-phenyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 24746718) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-N-phenyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-N-phenyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 24746718 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-N-phenyl-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=C[C@@H](c2ccc(C(F)(F)F)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C23H24F3NO4/c24-23(25,26)18-10-8-16(9-11-18)17-14-20(22(29)27-19-6-2-1-3-7-19)31-21(15-17)30-13-5-4-12-28/h1-3,6-11,14,17,21,28H,4-5,12-13,15H2,(H,27,29)/t17-,21+/m1/s1 |
| InChIKey | AJYKLACDXRYGQD-UTKZUKDTSA-N |
| XLogP | 4.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|