C20H24F3NO4 — CID 24746705
(2S,4S)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 24746705) has the molecular formula C20H24F3NO4 and a molecular weight of 399.41 g/mol. Its IUPAC name is (2S,4S)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 24746705 |
| Molecular Formula | C20H24F3NO4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (2S,4S)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NC1CC1)C1=C[C@@H](c2ccc(C(F)(F)F)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C20H24F3NO4/c21-20(22,23)15-5-3-13(4-6-15)14-11-17(19(26)24-16-7-8-16)28-18(12-14)27-10-2-1-9-25/h3-6,11,14,16,18,25H,1-2,7-10,12H2,(H,24,26)/t14-,18+/m1/s1 |
| InChIKey | YMYRABYOWCTMON-KDOFPFPSSA-N |
| XLogP | 3.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|