C21H23NO4 — CID 23930850
(2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23930850) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23930850 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2S,4S)-4-(4-ethynylphenyl)-2-(4-hydroxybutoxy)-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#CCNC(=O)C1=C[C@@H](c2ccc(C#C)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C21H23NO4/c1-3-11-22-21(24)19-14-18(17-9-7-16(4-2)8-10-17)15-20(26-19)25-13-6-5-12-23/h1-2,7-10,14,18,20,23H,5-6,11-13,15H2,(H,22,24)/t18-,20+/m1/s1 |
| InChIKey | UKJAZFVFJWWNRA-QUCCMNQESA-N |
| XLogP | 1.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|