C24H28FNO5 — CID 23930846
(2S,4S)-N-[(4-fluorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23930846) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is (2S,4S)-N-[(4-fluorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-[(4-fluorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23930846 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (2S,4S)-N-[(4-fluorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-methoxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COc1ccc([C@@H]2C=C(C(=O)NCc3ccc(F)cc3)O[C@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C24H28FNO5/c1-29-21-10-6-18(7-11-21)19-14-22(31-23(15-19)30-13-3-2-12-27)24(28)26-16-17-4-8-20(25)9-5-17/h4-11,14,19,23,27H,2-3,12-13,15-16H2,1H3,(H,26,28)/t19-,23+/m1/s1 |
| InChIKey | OHBWUNFVVHVOMS-XXBNENTESA-N |
| XLogP | 3.65 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|