C20H26FNO4 — CID 23818351
(2R,4R)-N-cyclobutyl-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23818351) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is (2R,4R)-N-cyclobutyl-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-cyclobutyl-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23818351 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2R,4R)-N-cyclobutyl-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NC1CCC1)C1=C[C@H](c2ccc(F)cc2)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C20H26FNO4/c21-16-8-6-14(7-9-16)15-12-18(20(24)22-17-4-3-5-17)26-19(13-15)25-11-2-1-10-23/h6-9,12,15,17,19,23H,1-5,10-11,13H2,(H,22,24)/t15-,19+/m0/s1 |
| InChIKey | BOFMLVOIHQJGSQ-HNAYVOBHSA-N |
| XLogP | 3.00 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|