C25H27NO5 — CID 3479328
4-(1-benzofuran-3-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3479328) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-(1-benzofuran-3-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1-benzofuran-3-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3479328 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-(1-benzofuran-3-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1=CC(c2coc3ccccc23)CC(OCCCCO)O1 |
| InChI | InChI=1S/C25H27NO5/c27-12-6-7-13-29-24-15-19(21-17-30-22-11-5-4-10-20(21)22)14-23(31-24)25(28)26-16-18-8-2-1-3-9-18/h1-5,8-11,14,17,19,24,27H,6-7,12-13,15-16H2,(H,26,28) |
| InChIKey | VFZZHUJPXUZOFB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|