C23H27NO6 — CID 6667315
(2S,4S)-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6667315) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2S,4S)-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6667315 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2S,4S)-N-(cyclopropylmethyl)-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCC1CC1)C1=C[C@@H](c2coc3ccccc3c2=O)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C23H27NO6/c25-9-3-4-10-28-21-12-16(11-20(30-21)23(27)24-13-15-7-8-15)18-14-29-19-6-2-1-5-17(19)22(18)26/h1-2,5-6,11,14-16,21,25H,3-4,7-10,12-13H2,(H,24,27)/t16-,21+/m1/s1 |
| InChIKey | FYARYDNZRJPFOS-IERDGZPVSA-N |
| XLogP | 2.82 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|