C29H35N3O6 — CID 6669307
(2S,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1-benzofuran-3-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669307) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is (2S,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1-benzofuran-3-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1-benzofuran-3-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669307 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | (2S,4S)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1-benzofuran-3-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)CCCCNC(=O)C1=C[C@@H](c2coc3ccccc23)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C29H35N3O6/c30-23-10-2-3-11-24(23)32-27(34)13-5-6-14-31-29(35)26-17-20(18-28(38-26)36-16-8-7-15-33)22-19-37-25-12-4-1-9-21(22)25/h1-4,9-12,17,19-20,28,33H,5-8,13-16,18,30H2,(H,31,35)(H,32,34)/t20-,28+/m1/s1 |
| InChIKey | OCXRIBSRUIGAES-NGOKVRLYSA-N |
| XLogP | 4.44 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|