C35H38N4O6 — CID 6667305
(2S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6667305) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is (2S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6667305 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (2S,4S)-4-(1-acetylindol-3-yl)-N-[5-(2-aminoanilino)-5-oxopentyl]-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)n1cc([C@@H]2C=C(C(=O)NCCCCC(=O)Nc3ccccc3N)O[C@H](OCc3ccc(CO)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C35H38N4O6/c1-23(41)39-20-28(27-8-2-5-11-31(27)39)26-18-32(45-34(19-26)44-22-25-15-13-24(21-40)14-16-25)35(43)37-17-7-6-12-33(42)38-30-10-4-3-9-29(30)36/h2-5,8-11,13-16,18,20,26,34,40H,6-7,12,17,19,21-22,36H2,1H3,(H,37,43)(H,38,42)/t26-,34+/m1/s1 |
| InChIKey | TWAPJMNENWDWPF-SFRLIIPVSA-N |
| XLogP | 5.23 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|