C32H41N5O6 — CID 6669663
(2R,4R)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669663) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is (2R,4R)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669663 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | (2R,4R)-N-[5-(2-aminoanilino)-5-oxopentyl]-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1c([C@H]2C=C(C(=O)NCCCCC(=O)Nc3ccccc3N)O[C@@H](OCCCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C32H41N5O6/c1-22-30(32(41)37(36(22)2)24-12-4-3-5-13-24)23-20-27(43-29(21-23)42-19-11-10-18-38)31(40)34-17-9-8-16-28(39)35-26-15-7-6-14-25(26)33/h3-7,12-15,20,23,29,38H,8-11,16-19,21,33H2,1-2H3,(H,34,40)(H,35,39)/t23-,29+/m0/s1 |
| InChIKey | PDKOJZAAABSKRS-MUAVYFROSA-N |
| XLogP | 3.49 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|