C27H32N4O6 — CID 3625481
N-(2-aminophenyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3625481) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2-aminophenyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3625481 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-(2-aminophenyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-[2-(2-hydroxyethoxy)ethoxy]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1c(C2C=C(C(=O)Nc3ccccc3N)OC(OCCOCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H32N4O6/c1-18-25(27(34)31(30(18)2)20-8-4-3-5-9-20)19-16-23(26(33)29-22-11-7-6-10-21(22)28)37-24(17-19)36-15-14-35-13-12-32/h3-11,16,19,24,32H,12-15,17,28H2,1-2H3,(H,29,33) |
| InChIKey | DBPQAIGONPKCDZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|