C26H37N3O7 — CID 3672892
N-(2,2-dimethoxyethyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3672892) has the molecular formula C26H37N3O7 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3672892 |
| Molecular Formula | C26H37N3O7 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-methyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COC(CN(C)C(=O)C1=CC(c2c(C)n(C)n(-c3ccccc3)c2=O)CC(OCCCCO)O1)OC |
| InChI | InChI=1S/C26H37N3O7/c1-18-24(26(32)29(28(18)3)20-11-7-6-8-12-20)19-15-21(25(31)27(2)17-23(33-4)34-5)36-22(16-19)35-14-10-9-13-30/h6-8,11-12,15,19,22-23,30H,9-10,13-14,16-17H2,1-5H3 |
| InChIKey | KPVOGVACWWYZFM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|