C28H34N6O7 — CID 3379795
4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3379795) has the molecular formula C28H34N6O7 and a molecular weight of 566.62 g/mol. Its IUPAC name is 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3379795 |
| Molecular Formula | C28H34N6O7 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1c(C2C=C(C(=O)NCCNc3ccc([N+](=O)[O-])cn3)OC(OCCCCO)C2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H34N6O7/c1-19-26(28(37)33(32(19)2)21-8-4-3-5-9-21)20-16-23(41-25(17-20)40-15-7-6-14-35)27(36)30-13-12-29-24-11-10-22(18-31-24)34(38)39/h3-5,8-11,16,18,20,25,35H,6-7,12-15,17H2,1-2H3,(H,29,31)(H,30,36) |
| InChIKey | IRQCLNDDVGJCAF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|