C20H24N2O5S — CID 23815342
(2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23815342) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23815342 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S,4S)-N-(2-aminophenyl)-2-[2-(2-hydroxyethoxy)ethoxy]-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)C1=C[C@@H](c2cccs2)C[C@@H](OCCOCCO)O1 |
| InChI | InChI=1S/C20H24N2O5S/c21-15-4-1-2-5-16(15)22-20(24)17-12-14(18-6-3-11-28-18)13-19(27-17)26-10-9-25-8-7-23/h1-6,11-12,14,19,23H,7-10,13,21H2,(H,22,24)/t14-,19+/m1/s1 |
| InChIKey | ZLTPHDILJQWFMU-KUHUBIRLSA-N |
| XLogP | 2.71 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|