C20H23NO6S — CID 6672244
(2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-(2-hydroxyphenyl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672244) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-(2-hydroxyphenyl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-(2-hydroxyphenyl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672244 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (2R,4R)-2-[2-(2-hydroxyethoxy)ethoxy]-N-(2-hydroxyphenyl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1=C[C@H](c2cccs2)C[C@H](OCCOCCO)O1 |
| InChI | InChI=1S/C20H23NO6S/c22-7-8-25-9-10-26-19-13-14(18-6-3-11-28-18)12-17(27-19)20(24)21-15-4-1-2-5-16(15)23/h1-6,11-12,14,19,22-23H,7-10,13H2,(H,21,24)/t14-,19+/m0/s1 |
| InChIKey | XMFOLMSSLFDBSU-IFXJQAMLSA-N |
| XLogP | 2.83 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|