C18H25NO5S — CID 23958605
[(2S,4S)-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]-morpholin-4-ylmethanone (PubChem CID 23958605) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is [(2S,4S)-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,4S)-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23958605 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(2S,4S)-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1=C[C@@H](c2cccs2)C[C@@H](OCCCCO)O1)N1CCOCC1 |
| InChI | InChI=1S/C18H25NO5S/c20-7-1-2-8-23-17-13-14(16-4-3-11-25-16)12-15(24-17)18(21)19-5-9-22-10-6-19/h3-4,11-12,14,17,20H,1-2,5-10,13H2/t14-,17+/m1/s1 |
| InChIKey | AGXPXAQLAXEUPQ-PBHICJAKSA-N |
| XLogP | 2.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|