C21H29BrN2O4 — CID 44511242
[(2S,4S)-4-(4-bromophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 44511242) has the molecular formula C21H29BrN2O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is [(2S,4S)-4-(4-bromophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(2S,4S)-4-(4-bromophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 44511242 |
| Molecular Formula | C21H29BrN2O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [(2S,4S)-4-(4-bromophenyl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2=C[C@@H](c3ccc(Br)cc3)C[C@@H](OCCCCO)O2)CC1 |
| InChI | InChI=1S/C21H29BrN2O4/c1-23-8-10-24(11-9-23)21(26)19-14-17(16-4-6-18(22)7-5-16)15-20(28-19)27-13-3-2-12-25/h4-7,14,17,20,25H,2-3,8-13,15H2,1H3/t17-,20+/m1/s1 |
| InChIKey | OVYFWPQKJLRJHK-XLIONFOSSA-N |
| XLogP | 2.73 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|