C17H21NO6 — CID 23789428
(2R,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23789428) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2R,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23789428 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | NC(=O)C1=C[C@H](c2ccc3c(c2)OCO3)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C17H21NO6/c18-17(20)15-8-12(9-16(24-15)21-6-2-1-5-19)11-3-4-13-14(7-11)23-10-22-13/h3-4,7-8,12,16,19H,1-2,5-6,9-10H2,(H2,18,20)/t12-,16+/m0/s1 |
| InChIKey | JODHVFZZAXIHKU-BLLLJJGKSA-N |
| XLogP | 1.40 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|