C22H23NO7 — CID 6672145
(2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672145) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672145 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2R,4R)-4-(1,3-benzodioxol-5-yl)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1=C[C@H](c2ccc3c(c2)OCO3)C[C@H](OCCCO)O1 |
| InChI | InChI=1S/C22H23NO7/c24-8-1-9-27-21-12-15(14-2-7-18-19(10-14)29-13-28-18)11-20(30-21)22(26)23-16-3-5-17(25)6-4-16/h2-7,10-11,15,21,24-25H,1,8-9,12-13H2,(H,23,26)/t15-,21+/m0/s1 |
| InChIKey | SXYNVDBGXSQTLN-YCRPNKLZSA-N |
| XLogP | 2.87 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|