C17H20O7 — CID 4127964
4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 4127964) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 4127964 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=CC(c2ccc3c(c2)OCO3)CC(OCCCCO)O1 |
| InChI | InChI=1S/C17H20O7/c18-5-1-2-6-21-16-9-12(8-15(24-16)17(19)20)11-3-4-13-14(7-11)23-10-22-13/h3-4,7-8,12,16,18H,1-2,5-6,9-10H2,(H,19,20) |
| InChIKey | GXKIHCANXYMZKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|