C25H29NO6 — CID 23760582
(2S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23760582) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23760582 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (2S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1=C[C@@H](c2ccc3c(c2)OCO3)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C25H29NO6/c27-12-4-5-13-29-24-16-20(19-8-9-21-22(14-19)31-17-30-21)15-23(32-24)25(28)26-11-10-18-6-2-1-3-7-18/h1-3,6-9,14-15,20,24,27H,4-5,10-13,16-17H2,(H,26,28)/t20-,24+/m1/s1 |
| InChIKey | SDOXXRPVKSTMEJ-YKSBVNFPSA-N |
| XLogP | 3.28 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|