C24H28INO4 — CID 23902826
(2S,4S)-2-(4-hydroxybutoxy)-4-(4-iodophenyl)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23902826) has the molecular formula C24H28INO4 and a molecular weight of 521.40 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-4-(4-iodophenyl)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-4-(4-iodophenyl)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23902826 |
| Molecular Formula | C24H28INO4 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-4-(4-iodophenyl)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1=C[C@@H](c2ccc(I)cc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C24H28INO4/c25-21-10-8-19(9-11-21)20-16-22(30-23(17-20)29-15-5-4-14-27)24(28)26-13-12-18-6-2-1-3-7-18/h1-3,6-11,16,20,23,27H,4-5,12-15,17H2,(H,26,28)/t20-,23+/m1/s1 |
| InChIKey | XYDGGISBCHQTNI-OFNKIYASSA-N |
| XLogP | 4.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|