C28H32N2O5 — CID 23930774
(2R,4R)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23930774) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2R,4R)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23930774 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (2R,4R)-4-(1-acetylindol-3-yl)-2-(4-hydroxybutoxy)-N-(2-phenylethyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)n1cc([C@H]2C=C(C(=O)NCCc3ccccc3)O[C@@H](OCCCCO)C2)c2ccccc21 |
| InChI | InChI=1S/C28H32N2O5/c1-20(32)30-19-24(23-11-5-6-12-25(23)30)22-17-26(35-27(18-22)34-16-8-7-15-31)28(33)29-14-13-21-9-3-2-4-10-21/h2-6,9-12,17,19,22,27,31H,7-8,13-16,18H2,1H3,(H,29,33)/t22-,27+/m0/s1 |
| InChIKey | CJGPUHNPBNUIOL-WXVAWEFUSA-N |
| XLogP | 4.16 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|