C24H27NO6 — CID 3658083
4-(1,3-benzodioxol-5-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 3658083) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 3658083 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-benzyl-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1=CC(c2ccc3c(c2)OCO3)CC(OCCCCO)O1 |
| InChI | InChI=1S/C24H27NO6/c26-10-4-5-11-28-23-14-19(18-8-9-20-21(12-18)30-16-29-20)13-22(31-23)24(27)25-15-17-6-2-1-3-7-17/h1-3,6-9,12-13,19,23,26H,4-5,10-11,14-16H2,(H,25,27) |
| InChIKey | ZNMXAZGJBVGHTM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|