C23H26INO4 — CID 6672029
(2S,4S)-2-(4-hydroxybutoxy)-N-[(4-iodophenyl)methyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672029) has the molecular formula C23H26INO4 and a molecular weight of 507.37 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-N-[(4-iodophenyl)methyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-N-[(4-iodophenyl)methyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672029 |
| Molecular Formula | C23H26INO4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-N-[(4-iodophenyl)methyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccc(I)cc1)C1=C[C@@H](c2ccccc2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C23H26INO4/c24-20-10-8-17(9-11-20)16-25-23(27)21-14-19(18-6-2-1-3-7-18)15-22(29-21)28-13-5-4-12-26/h1-3,6-11,14,19,22,26H,4-5,12-13,15-16H2,(H,25,27)/t19-,22+/m1/s1 |
| InChIKey | HWSWFQVYIQPZED-KNQAVFIVSA-N |
| XLogP | 4.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|