C30H33N3O5 — CID 6669542
(2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(4-hydroxybutoxy)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669542) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(4-hydroxybutoxy)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(4-hydroxybutoxy)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669542 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-(4-hydroxybutoxy)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)C2=C[C@H](c3ccccc3)C[C@H](OCCCCO)O2)cc1 |
| InChI | InChI=1S/C30H33N3O5/c31-25-10-4-5-11-26(25)33-29(35)23-14-12-21(13-15-23)20-32-30(36)27-18-24(22-8-2-1-3-9-22)19-28(38-27)37-17-7-6-16-34/h1-5,8-15,18,24,28,34H,6-7,16-17,19-20,31H2,(H,32,36)(H,33,35)/t24-,28+/m0/s1 |
| InChIKey | LGFFLLXIULZWGT-RBJSKKJNSA-N |
| XLogP | 4.34 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|