C33H33N3O8 — CID 6669799
(2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669799) has the molecular formula C33H33N3O8 and a molecular weight of 599.64 g/mol. Its IUPAC name is (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669799 |
| Molecular Formula | C33H33N3O8 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | (2R,4R)-N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)C2=C[C@H](c3coc4ccccc4c3=O)C[C@H](OCCOCCO)O2)cc1 |
| InChI | InChI=1S/C33H33N3O8/c34-26-6-2-3-7-27(26)36-32(39)22-11-9-21(10-12-22)19-35-33(40)29-17-23(18-30(44-29)42-16-15-41-14-13-37)25-20-43-28-8-4-1-5-24(28)31(25)38/h1-12,17,20,23,30,37H,13-16,18-19,34H2,(H,35,40)(H,36,39)/t23-,30+/m0/s1 |
| InChIKey | QQRXRCRIKYLBDH-YUDQIZAISA-N |
| XLogP | 3.68 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|