C25H25NO7 — CID 6667258
(2S,4S)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6667258) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is (2S,4S)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6667258 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (2S,4S)-2-(4-hydroxybutoxy)-N-(2-hydroxyphenyl)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1=C[C@@H](c2coc3ccccc3c2=O)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C25H25NO7/c27-11-5-6-12-31-23-14-16(18-15-32-21-10-4-1-7-17(21)24(18)29)13-22(33-23)25(30)26-19-8-2-3-9-20(19)28/h1-4,7-10,13,15-16,23,27-28H,5-6,11-12,14H2,(H,26,30)/t16-,23+/m1/s1 |
| InChIKey | PIMMMRCXCRMURV-MWTRTKDXSA-N |
| XLogP | 3.64 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|