C26H27NO7 — CID 5087233
N-benzyl-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 5087233) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is N-benzyl-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-benzyl-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 5087233 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-benzyl-2-[2-(2-hydroxyethoxy)ethoxy]-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1=CC(c2coc3ccccc3c2=O)CC(OCCOCCO)O1 |
| InChI | InChI=1S/C26H27NO7/c28-10-11-31-12-13-32-24-15-19(21-17-33-22-9-5-4-8-20(22)25(21)29)14-23(34-24)26(30)27-16-18-6-2-1-3-7-18/h1-9,14,17,19,24,28H,10-13,15-16H2,(H,27,30) |
| InChIKey | VJJDQPJNAIOVOI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|