C22H25NO6 — CID 24746706
(2R,4R)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 24746706) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is (2R,4R)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 24746706 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (2R,4R)-N-cyclopropyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NC1CC1)C1=C[C@H](c2coc3ccccc3c2=O)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C22H25NO6/c24-9-3-4-10-27-20-12-14(11-19(29-20)22(26)23-15-7-8-15)17-13-28-18-6-2-1-5-16(18)21(17)25/h1-2,5-6,11,13-15,20,24H,3-4,7-10,12H2,(H,23,26)/t14-,20+/m0/s1 |
| InChIKey | PCYUEOFMSPOADM-VBKZILBWSA-N |
| XLogP | 2.57 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|