C26H26ClNO6 — CID 23807523
(2R,4R)-N-[(4-chlorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23807523) has the molecular formula C26H26ClNO6 and a molecular weight of 483.95 g/mol. Its IUPAC name is (2R,4R)-N-[(4-chlorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-[(4-chlorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23807523 |
| Molecular Formula | C26H26ClNO6 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (2R,4R)-N-[(4-chlorophenyl)methyl]-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1=C[C@H](c2coc3ccccc3c2=O)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C26H26ClNO6/c27-19-9-7-17(8-10-19)15-28-26(31)23-13-18(14-24(34-23)32-12-4-3-11-29)21-16-33-22-6-2-1-5-20(22)25(21)30/h1-2,5-10,13,16,18,24,29H,3-4,11-12,14-15H2,(H,28,31)/t18-,24+/m0/s1 |
| InChIKey | WIGQWQRXPCEMCG-MHECFPHRSA-N |
| XLogP | 4.27 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|